C20H36N4O6 — CID 59141656
1,3a,6a-triethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)imidazo[4,5-d]imidazole-2,5-dione (PubChem CID 59141656) has the molecular formula C20H36N4O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1,3a,6a-triethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)imidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 1,3a,6a-triethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)imidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 59141656 |
| Molecular Formula | C20H36N4O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 1,3a,6a-triethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)imidazo[4,5-d]imidazole-2,5-dione |
| SMILES | CCN1C(=O)N(COC/C=C/COC)C2(CC)N(COC)C(=O)N(COC)C12CC |
| InChI | InChI=1S/C20H36N4O6/c1-7-19-20(8-2,23(15-29-6)18(26)22(19)14-28-5)24(17(25)21(19)9-3)16-30-13-11-10-12-27-4/h10-11H,7-9,12-16H2,1-6H3/b11-10+ |
| InChIKey | HTXKOPRINYHCGJ-ZHACJKMWSA-N |
| XLogP | 2.08 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|