C17H30N6O6 — CID 59141662
N-[4-[ethyl(hydroxy)amino]-6-[[(E)-4-methoxybut-2-enoxy]methyl-(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide (PubChem CID 59141662) has the molecular formula C17H30N6O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[4-[ethyl(hydroxy)amino]-6-[[(E)-4-methoxybut-2-enoxy]methyl-(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide.
| Compound Name | N-[4-[ethyl(hydroxy)amino]-6-[[(E)-4-methoxybut-2-enoxy]methyl-(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide |
|---|---|
| PubChem CID | 59141662 |
| Molecular Formula | C17H30N6O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[4-[ethyl(hydroxy)amino]-6-[[(E)-4-methoxybut-2-enoxy]methyl-(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(methoxymethyl)acetamide |
| SMILES | CCN(O)c1nc(N(COC)COC/C=C/COC)nc(N(COC)C(C)=O)n1 |
| InChI | InChI=1S/C17H30N6O6/c1-6-23(25)17-19-15(18-16(20-17)22(13-28-5)14(2)24)21(11-27-4)12-29-10-8-7-9-26-3/h7-8,25H,6,9-13H2,1-5H3/b8-7+ |
| InChIKey | FBMRHZUYCGROKA-BQYQJAHWSA-N |
| XLogP | 0.63 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|