C16H28N4O6 — CID 59141679
1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 59141679) has the molecular formula C16H28N4O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 59141679 |
| Molecular Formula | C16H28N4O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4,6-bis(methoxymethyl)-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | CCN1C(=O)N(COC/C=C/COC)C2C1N(COC)C(=O)N2COC |
| InChI | InChI=1S/C16H28N4O6/c1-5-17-13-14(19(11-25-4)16(22)18(13)10-24-3)20(15(17)21)12-26-9-7-6-8-23-2/h6-7,13-14H,5,8-12H2,1-4H3/b7-6+ |
| InChIKey | PWYDNFRGUPMVAT-VOTSOKGWSA-N |
| XLogP | 0.52 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|