C22H31N7O8 — CID 59141691
1,3-bis(ethenyl)-5-[[1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4-(methoxymethyl)-2,5-dioxo-3a,6a-dihydroimidazo[4,5-d]imidazol-6-yl]methyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 59141691) has the molecular formula C22H31N7O8 and a molecular weight of 521.53 g/mol. Its IUPAC name is 1,3-bis(ethenyl)-5-[[1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4-(methoxymethyl)-2,5-dioxo-3a,6a-dihydroimidazo[4,5-d]imidazol-6-yl]methyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(ethenyl)-5-[[1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4-(methoxymethyl)-2,5-dioxo-3a,6a-dihydroimidazo[4,5-d]imidazol-6-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59141691 |
| Molecular Formula | C22H31N7O8 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 1,3-bis(ethenyl)-5-[[1-ethyl-3-[[(E)-4-methoxybut-2-enoxy]methyl]-4-(methoxymethyl)-2,5-dioxo-3a,6a-dihydroimidazo[4,5-d]imidazol-6-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=Cn1c(=O)n(C=C)c(=O)n(CN2C(=O)N(COC)C3C2N(CC)C(=O)N3COC/C=C/COC)c1=O |
| InChI | InChI=1S/C22H31N7O8/c1-6-23-16-17(29(18(23)30)15-37-12-10-9-11-35-4)28(14-36-5)22(34)26(16)13-27-20(32)24(7-2)19(31)25(8-3)21(27)33/h7-10,16-17H,2-3,6,11-15H2,1,4-5H3/b10-9+ |
| InChIKey | YLZUFONTPXBLQL-MDZDMXLPSA-N |
| XLogP | -0.74 |
| TPSA | 140.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|