About ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate
ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate (PubChem CID 59141971) has the molecular formula C23H31NO5
and a molecular weight of 401.50 g/mol. Its IUPAC name is ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate.
Molecular Properties
| Compound Name | ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate |
| PubChem CID | 59141971 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate |
| SMILES | CCOC(=O)OC1=C(c2c(C)cc(C)cc2CC)C(=O)NC12CCC(OC)CC2 |
| InChI | InChI=1S/C23H31NO5/c1-6-16-13-14(3)12-15(4)18(16)19-20(29-22(26)28-7-2)23(24-21(19)25)10-8-17(27-5)9-11-23/h12-13,17H,6-11H2,1-5H3,(H,24,25) |
| InChIKey | PTPWAGHNWZOOBY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
The IUPAC name of ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate (CID 59141971) is ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate.
What is the SMILES notation for ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
The canonical SMILES for ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate is CCOC(=O)OC1=C(c2c(C)cc(C)cc2CC)C(=O)NC12CCC(OC)CC2.
What is the InChIKey of ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
The InChIKey is PTPWAGHNWZOOBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO5/c1-6-16-13-14(3)12-15(4)18(16)19-20(29-22(26)28-7-2)23(24-21(19)25)10-8-17(27-5)9-11-23/h12-13,17H,6-11H2,1-5H3,(H,24,25).
What are the key properties of ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate?
ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate has a molecular weight of 401.50 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [3-(2-ethyl-4,6-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] carbonate is sourced from PubChem (CID 59141971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).