About 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one
4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one (PubChem CID 59142003) has the molecular formula C17H20INO2
and a molecular weight of 397.26 g/mol. Its IUPAC name is 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 59142003 |
| Molecular Formula | C17H20INO2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one |
| SMILES | Cc1cc(I)cc(C)c1C1=C(O)C2(CCCCC2)NC1=O |
| InChI | InChI=1S/C17H20INO2/c1-10-8-12(18)9-11(2)13(10)14-15(20)17(19-16(14)21)6-4-3-5-7-17/h8-9,20H,3-7H2,1-2H3,(H,19,21) |
| InChIKey | UCHHWPSQIXFRPG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one?
The IUPAC name of 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one (CID 59142003) is 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one is Cc1cc(I)cc(C)c1C1=C(O)C2(CCCCC2)NC1=O.
What is the InChIKey of 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one?
The InChIKey is UCHHWPSQIXFRPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20INO2/c1-10-8-12(18)9-11(2)13(10)14-15(20)17(19-16(14)21)6-4-3-5-7-17/h8-9,20H,3-7H2,1-2H3,(H,19,21).
What are the key properties of 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one?
4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one has a molecular weight of 397.26 g/mol, XLogP of 4.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-(4-iodo-2,6-dimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 59142003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).