C15H29N2O5P — CID 59142065
(2R,5S)-2-(2-diethoxyphosphorylethyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 59142065) has the molecular formula C15H29N2O5P and a molecular weight of 348.38 g/mol. Its IUPAC name is (2R,5S)-2-(2-diethoxyphosphorylethyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2R,5S)-2-(2-diethoxyphosphorylethyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 59142065 |
| Molecular Formula | C15H29N2O5P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2R,5S)-2-(2-diethoxyphosphorylethyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | CCOP(=O)(CC[C@H]1N=C(OC)[C@H](C(C)C)N=C1OC)OCC |
| InChI | InChI=1S/C15H29N2O5P/c1-7-21-23(18,22-8-2)10-9-12-14(19-5)17-13(11(3)4)15(16-12)20-6/h11-13H,7-10H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | SCMPGCUSKCFGLY-OLZOCXBDSA-N |
| XLogP | 3.14 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|