About 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol
2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol (PubChem CID 59142069) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol |
| PubChem CID | 59142069 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol |
| SMILES | Cc1c(O)c(CO)c(CO)c(O)c1C(C)C |
| InChI | InChI=1S/C12H18O4/c1-6(2)10-7(3)11(15)8(4-13)9(5-14)12(10)16/h6,13-16H,4-5H2,1-3H3 |
| InChIKey | SWMBLIKTBIVPQT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol?
The IUPAC name of 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol (CID 59142069) is 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol.
What is the SMILES notation for 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol?
The canonical SMILES for 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol is Cc1c(O)c(CO)c(CO)c(O)c1C(C)C.
What is the InChIKey of 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol?
The InChIKey is SWMBLIKTBIVPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-6(2)10-7(3)11(15)8(4-13)9(5-14)12(10)16/h6,13-16H,4-5H2,1-3H3.
What are the key properties of 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol?
2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol has a molecular weight of 226.27 g/mol, XLogP of 1.51, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(hydroxymethyl)-5-methyl-6-propan-2-ylbenzene-1,4-diol is sourced from PubChem (CID 59142069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).