C29H26N4O8S — CID 59142484
benzhydryl (2S,3R,5R,6Z)-3-(carbamoyloxymethyl)-6-[(4-carbamoyl-2-pyridinyl)methylidene]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 59142484) has the molecular formula C29H26N4O8S and a molecular weight of 590.61 g/mol. Its IUPAC name is benzhydryl (2S,3R,5R,6Z)-3-(carbamoyloxymethyl)-6-[(4-carbamoyl-2-pyridinyl)methylidene]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,3R,5R,6Z)-3-(carbamoyloxymethyl)-6-[(4-carbamoyl-2-pyridinyl)methylidene]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59142484 |
| Molecular Formula | C29H26N4O8S |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | benzhydryl (2S,3R,5R,6Z)-3-(carbamoyloxymethyl)-6-[(4-carbamoyl-2-pyridinyl)methylidene]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(COC(N)=O)[C@H](C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)/C(=C/c3cc(C(N)=O)ccn3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C29H26N4O8S/c1-29(16-40-28(31)37)23(27(36)41-22(17-8-4-2-5-9-17)18-10-6-3-7-11-18)33-25(35)21(26(33)42(29,38)39)15-20-14-19(24(30)34)12-13-32-20/h2-15,22-23,26H,16H2,1H3,(H2,30,34)(H2,31,37)/b21-15-/t23-,26+,29-/m0/s1 |
| InChIKey | GBGGTIPXANQFQA-IEOCDYHFSA-N |
| XLogP | 1.72 |
| TPSA | 189.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|