C15H16N3NaO5S — CID 59142564
sodium (2S,5R,6Z)-6-[[4-(aminomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 59142564) has the molecular formula C15H16N3NaO5S and a molecular weight of 373.37 g/mol. Its IUPAC name is sodium (2S,5R,6Z)-6-[[4-(aminomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | sodium (2S,5R,6Z)-6-[[4-(aminomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59142564 |
| Molecular Formula | C15H16N3NaO5S |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | sodium (2S,5R,6Z)-6-[[4-(aminomethyl)-2-pyridinyl]methylidene]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)[O-])N2C(=O)/C(=C/c3cc(CN)ccn3)[C@H]2S1(=O)=O.[Na+] |
| InChI | InChI=1S/C15H17N3O5S.Na/c1-15(2)11(14(20)21)18-12(19)10(13(18)24(15,22)23)6-9-5-8(7-16)3-4-17-9;/h3-6,11,13H,7,16H2,1-2H3,(H,20,21);/q;+1/p-1/b10-6-;/t11-,13+;/m0./s1 |
| InChIKey | JSMJIXUYUAXDJP-VXBZLOSVSA-M |
| XLogP | -4.58 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|