About 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole
3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole (PubChem CID 59142831) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole |
| PubChem CID | 59142831 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole |
| SMILES | CC(C)CC1CNC=C1C(C)C |
| InChI | InChI=1S/C11H21N/c1-8(2)5-10-6-12-7-11(10)9(3)4/h7-10,12H,5-6H2,1-4H3 |
| InChIKey | ADSXFMXIRGMSJY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole?
The IUPAC name of 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole (CID 59142831) is 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole is CC(C)CC1CNC=C1C(C)C.
What is the InChIKey of 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole?
The InChIKey is ADSXFMXIRGMSJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-8(2)5-10-6-12-7-11(10)9(3)4/h7-10,12H,5-6H2,1-4H3.
What are the key properties of 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole?
3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole has a molecular weight of 167.30 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropyl)-4-propan-2-yl-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 59142831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).