About 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one
5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one (PubChem CID 59143498) has the molecular formula C17H30O2
and a molecular weight of 266.43 g/mol. Its IUPAC name is 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one.
Molecular Properties
| Compound Name | 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one |
| PubChem CID | 59143498 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one |
| SMILES | C=C(C)CC(OCC1CCCC1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C17H30O2/c1-13(2)10-16(15(18)11-17(3,4)5)19-12-14-8-6-7-9-14/h14,16H,1,6-12H2,2-5H3 |
| InChIKey | MNZMXSZSSWUCMR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one?
The IUPAC name of 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one (CID 59143498) is 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one.
What is the SMILES notation for 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one?
The canonical SMILES for 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one is C=C(C)CC(OCC1CCCC1)C(=O)CC(C)(C)C.
What is the InChIKey of 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one?
The InChIKey is MNZMXSZSSWUCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-13(2)10-16(15(18)11-17(3,4)5)19-12-14-8-6-7-9-14/h14,16H,1,6-12H2,2-5H3.
What are the key properties of 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one?
5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one has a molecular weight of 266.43 g/mol, XLogP of 4.53, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclopentylmethoxy)-2,2,7-trimethyloct-7-en-4-one is sourced from PubChem (CID 59143498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).