About 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one
1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one (PubChem CID 59143502) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one |
| PubChem CID | 59143502 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one |
| SMILES | C=CCOC(CC1CC1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H24O2/c1-5-8-16-13(9-11-6-7-11)12(15)10-14(2,3)4/h5,11,13H,1,6-10H2,2-4H3 |
| InChIKey | ONCQYXDSFFZCAA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one?
The IUPAC name of 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one (CID 59143502) is 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one.
What is the SMILES notation for 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one?
The canonical SMILES for 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one is C=CCOC(CC1CC1)C(=O)CC(C)(C)C.
What is the InChIKey of 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one?
The InChIKey is ONCQYXDSFFZCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-5-8-16-13(9-11-6-7-11)12(15)10-14(2,3)4/h5,11,13H,1,6-10H2,2-4H3.
What are the key properties of 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one?
1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one has a molecular weight of 224.34 g/mol, XLogP of 3.36, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-5,5-dimethyl-2-prop-2-enoxyhexan-3-one is sourced from PubChem (CID 59143502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).