About 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one
1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one (PubChem CID 59143646) has the molecular formula C20H36O
and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one |
| PubChem CID | 59143646 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one |
| SMILES | CC(C)(C)CC(=O)C(CCC1CCCC1)CC1CCCC1 |
| InChI | InChI=1S/C20H36O/c1-20(2,3)15-19(21)18(14-17-10-6-7-11-17)13-12-16-8-4-5-9-16/h16-18H,4-15H2,1-3H3 |
| InChIKey | HYUFBHOPNMWVRP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one?
The IUPAC name of 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one (CID 59143646) is 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one.
What is the SMILES notation for 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one?
The canonical SMILES for 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one is CC(C)(C)CC(=O)C(CCC1CCCC1)CC1CCCC1.
What is the InChIKey of 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one?
The InChIKey is HYUFBHOPNMWVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O/c1-20(2,3)15-19(21)18(14-17-10-6-7-11-17)13-12-16-8-4-5-9-16/h16-18H,4-15H2,1-3H3.
What are the key properties of 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one?
1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one has a molecular weight of 292.51 g/mol, XLogP of 6.16, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-(cyclopentylmethyl)-6,6-dimethylheptan-4-one is sourced from PubChem (CID 59143646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).