About 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one
5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one (PubChem CID 59143683) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one.
Molecular Properties
| Compound Name | 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one |
| PubChem CID | 59143683 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one |
| SMILES | C=C(C)CC(OCC1CCCC1)C(=O)CC(C)C |
| InChI | InChI=1S/C16H28O2/c1-12(2)9-15(17)16(10-13(3)4)18-11-14-7-5-6-8-14/h12,14,16H,3,5-11H2,1-2,4H3 |
| InChIKey | MRJZBVPXCFAVHR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one?
The IUPAC name of 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one (CID 59143683) is 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one.
What is the SMILES notation for 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one?
The canonical SMILES for 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one is C=C(C)CC(OCC1CCCC1)C(=O)CC(C)C.
What is the InChIKey of 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one?
The InChIKey is MRJZBVPXCFAVHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-12(2)9-15(17)16(10-13(3)4)18-11-14-7-5-6-8-14/h12,14,16H,3,5-11H2,1-2,4H3.
What are the key properties of 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one?
5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one has a molecular weight of 252.40 g/mol, XLogP of 4.14, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclopentylmethoxy)-2,7-dimethyloct-7-en-4-one is sourced from PubChem (CID 59143683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).