About 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene
1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene (PubChem CID 59143933) has the molecular formula C19H18Cl2
and a molecular weight of 317.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene |
| PubChem CID | 59143933 |
| Molecular Formula | C19H18Cl2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene |
| SMILES | CC(C)C1=CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C19H18Cl2/c1-12(2)14-8-9-15(17-6-4-3-5-16(14)17)13-7-10-18(20)19(21)11-13/h3-8,10-12,15H,9H2,1-2H3 |
| InChIKey | PIMBAALTNOTMMX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene?
The IUPAC name of 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene (CID 59143933) is 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene?
The canonical SMILES for 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene is CC(C)C1=CCC(c2ccc(Cl)c(Cl)c2)c2ccccc21.
What is the InChIKey of 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene?
The InChIKey is PIMBAALTNOTMMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2/c1-12(2)14-8-9-15(17-6-4-3-5-16(14)17)13-7-10-18(20)19(21)11-13/h3-8,10-12,15H,9H2,1-2H3.
What are the key properties of 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene?
1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene has a molecular weight of 317.26 g/mol, XLogP of 6.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-4-propan-2-yl-1,2-dihydronaphthalene is sourced from PubChem (CID 59143933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).