C10H16N2O6S3 — CID 59144200
(4S)-6-aminoperoxysulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol (PubChem CID 59144200) has the molecular formula C10H16N2O6S3 and a molecular weight of 356.45 g/mol. Its IUPAC name is (4S)-6-aminoperoxysulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol.
| Compound Name | (4S)-6-aminoperoxysulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol |
|---|---|
| PubChem CID | 59144200 |
| Molecular Formula | C10H16N2O6S3 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (4S)-6-aminoperoxysulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-ol |
| SMILES | COCCCN1C[C@@H](O)c2cc(SOON)sc2S1(=O)=O |
| InChI | InChI=1S/C10H16N2O6S3/c1-16-4-2-3-12-6-8(13)7-5-9(20-18-17-11)19-10(7)21(12,14)15/h5,8,13H,2-4,6,11H2,1H3/t8-/m1/s1 |
| InChIKey | RXOXHHHZPCRDNS-MRVPVSSYSA-N |
| XLogP | 0.65 |
| TPSA | 111.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|