C31H35F2N5O4S — CID 59144231
N-[2-(dimethylamino)ethyl]-4-[[7-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,5-difluorophenyl]-1,3-benzoxazol-2-yl]amino]-N,2-dimethylbenzamide (PubChem CID 59144231) has the molecular formula C31H35F2N5O4S and a molecular weight of 611.72 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-[[7-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,5-difluorophenyl]-1,3-benzoxazol-2-yl]amino]-N,2-dimethylbenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-[[7-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,5-difluorophenyl]-1,3-benzoxazol-2-yl]amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 59144231 |
| Molecular Formula | C31H35F2N5O4S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-[[7-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,5-difluorophenyl]-1,3-benzoxazol-2-yl]amino]-N,2-dimethylbenzamide |
| SMILES | Cc1cc(Nc2nc3cccc(-c4cc(F)c(CN5CCS(=O)(=O)CC5)c(F)c4)c3o2)ccc1C(=O)N(C)CCN(C)C |
| InChI | InChI=1S/C31H35F2N5O4S/c1-20-16-22(8-9-23(20)30(39)37(4)11-10-36(2)3)34-31-35-28-7-5-6-24(29(28)42-31)21-17-26(32)25(27(33)18-21)19-38-12-14-43(40,41)15-13-38/h5-9,16-18H,10-15,19H2,1-4H3,(H,34,35) |
| InChIKey | XCYFTLJDPWRTJG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |