C14H20N2O — CID 59144793
(7R)-7-piperazin-1-yl-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 59144793) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (7R)-7-piperazin-1-yl-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (7R)-7-piperazin-1-yl-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 59144793 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (7R)-7-piperazin-1-yl-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | Oc1cccc2c1C[C@H](N1CCNCC1)CC2 |
| InChI | InChI=1S/C14H20N2O/c17-14-3-1-2-11-4-5-12(10-13(11)14)16-8-6-15-7-9-16/h1-3,12,15,17H,4-10H2/t12-/m1/s1 |
| InChIKey | GEXMVYUQTAYLMY-GFCCVEGCSA-N |
| XLogP | 1.15 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |