C28H30FN3S — CID 59145029
1-[4-(3-fluorophenyl)-10-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]-3-propylthiourea (PubChem CID 59145029) has the molecular formula C28H30FN3S and a molecular weight of 459.63 g/mol. Its IUPAC name is 1-[4-(3-fluorophenyl)-10-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]-3-propylthiourea.
| Compound Name | 1-[4-(3-fluorophenyl)-10-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]-3-propylthiourea |
|---|---|
| PubChem CID | 59145029 |
| Molecular Formula | C28H30FN3S |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 1-[4-(3-fluorophenyl)-10-phenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]-3-propylthiourea |
| SMILES | CCCNC(=S)Nc1cc2c3c(c1)C(c1cccc(F)c1)CCN3CCC2c1ccccc1 |
| InChI | InChI=1S/C28H30FN3S/c1-2-13-30-28(33)31-22-17-25-23(19-7-4-3-5-8-19)11-14-32-15-12-24(26(18-22)27(25)32)20-9-6-10-21(29)16-20/h3-10,16-18,23-24H,2,11-15H2,1H3,(H2,30,31,33) |
| InChIKey | KMFHRJIODQSXJQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|