C21H26N2O6S2 — CID 59145812
N-(4,5-dimethyl-1,2-oxazol-3-yl)-3-[4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)-5-methylthiophene-2-sulfonamide (PubChem CID 59145812) has the molecular formula C21H26N2O6S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,2-oxazol-3-yl)-3-[4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)-5-methylthiophene-2-sulfonamide.
| Compound Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-3-[4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 59145812 |
| Molecular Formula | C21H26N2O6S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-3-[4-(hydroxymethyl)phenyl]-N-(2-methoxyethoxymethyl)-5-methylthiophene-2-sulfonamide |
| SMILES | COCCOCN(c1noc(C)c1C)S(=O)(=O)c1sc(C)cc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C21H26N2O6S2/c1-14-11-19(18-7-5-17(12-24)6-8-18)21(30-14)31(25,26)23(13-28-10-9-27-4)20-15(2)16(3)29-22-20/h5-8,11,24H,9-10,12-13H2,1-4H3 |
| InChIKey | HRYCRYCURMFDPP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|