C30H49N — CID 59146384
(2E,4E,6E,8E)-2,3,4,5,6,7,8-heptamethyl-N-(2-methylpropyl)-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6,8-tetraen-1-imine (PubChem CID 59146384) has the molecular formula C30H49N and a molecular weight of 423.73 g/mol. Its IUPAC name is (2E,4E,6E,8E)-2,3,4,5,6,7,8-heptamethyl-N-(2-methylpropyl)-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4E,6E,8E)-2,3,4,5,6,7,8-heptamethyl-N-(2-methylpropyl)-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 59146384 |
| Molecular Formula | C30H49N |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 423.39 |
| IUPAC Name | (2E,4E,6E,8E)-2,3,4,5,6,7,8-heptamethyl-N-(2-methylpropyl)-9-(2,6,6-trimethylcyclohexen-1-yl)deca-2,4,6,8-tetraen-1-imine |
| SMILES | CC1=C(/C(C)=C(C)/C(C)=C(C)/C(C)=C(C)/C(C)=C(C)/C=N/CC(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H49N/c1-19(2)17-31-18-21(4)22(5)23(6)24(7)25(8)26(9)27(10)28(11)29-20(3)15-14-16-30(29,12)13/h18-19H,14-17H2,1-13H3/b22-21+,24-23+,26-25+,28-27+,31-18+ |
| InChIKey | WYCSMKZRIRLPEV-OYJRUTKHSA-N |
| XLogP | 9.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|