C8H7F5N2O — CID 59146508
2-(dimethylaminomethylidene)-4,4,5,5,5-pentafluoro-3-oxopentanenitrile (PubChem CID 59146508) has the molecular formula C8H7F5N2O and a molecular weight of 242.15 g/mol. Its IUPAC name is 2-(dimethylaminomethylidene)-4,4,5,5,5-pentafluoro-3-oxopentanenitrile.
| Compound Name | 2-(dimethylaminomethylidene)-4,4,5,5,5-pentafluoro-3-oxopentanenitrile |
|---|---|
| PubChem CID | 59146508 |
| Molecular Formula | C8H7F5N2O |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(dimethylaminomethylidene)-4,4,5,5,5-pentafluoro-3-oxopentanenitrile |
| SMILES | CN(C)C=C(C#N)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2O/c1-15(2)4-5(3-14)6(16)7(9,10)8(11,12)13/h4H,1-2H3 |
| InChIKey | BCSLFGSDBHBISQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|