C48H56N10O10 — CID 59146558
benzyl N-[3-[[3,6-bis[2-(phenylmethoxycarbonylamino)ethylcarbamoyl]-5-[3-(phenylmethoxycarbonylamino)propylamino]pyrazin-2-yl]amino]propyl]carbamate (PubChem CID 59146558) has the molecular formula C48H56N10O10 and a molecular weight of 933.04 g/mol. Its IUPAC name is benzyl N-[3-[[3,6-bis[2-(phenylmethoxycarbonylamino)ethylcarbamoyl]-5-[3-(phenylmethoxycarbonylamino)propylamino]pyrazin-2-yl]amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[[3,6-bis[2-(phenylmethoxycarbonylamino)ethylcarbamoyl]-5-[3-(phenylmethoxycarbonylamino)propylamino]pyrazin-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 59146558 |
| Molecular Formula | C48H56N10O10 |
| Molecular Weight | 933.04 g/mol |
| Exact Mass | 932.42 |
| IUPAC Name | benzyl N-[3-[[3,6-bis[2-(phenylmethoxycarbonylamino)ethylcarbamoyl]-5-[3-(phenylmethoxycarbonylamino)propylamino]pyrazin-2-yl]amino]propyl]carbamate |
| SMILES | O=C(NCCCNc1nc(C(=O)NCCNC(=O)OCc2ccccc2)c(NCCCNC(=O)OCc2ccccc2)nc1C(=O)NCCNC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C48H56N10O10/c59-43(51-27-29-55-47(63)67-33-37-19-9-3-10-20-37)39-41(49-23-13-25-53-45(61)65-31-35-15-5-1-6-16-35)57-40(44(60)52-28-30-56-48(64)68-34-38-21-11-4-12-22-38)42(58-39)50-24-14-26-54-46(62)66-32-36-17-7-2-8-18-36/h1-12,15-22H,13-14,23-34H2,(H,49,57)(H,50,58)(H,51,59)(H,52,60)(H,53,61)(H,54,62)(H,55,63)(H,56,64) |
| InChIKey | CUQVRVOTLMJMAX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 261.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.04 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|