C19H31NO5 — CID 59146564
ethyl (3R,4R,5S)-4-methyl-3-pentan-3-yloxy-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate (PubChem CID 59146564) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-4-methyl-3-pentan-3-yloxy-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-4-methyl-3-pentan-3-yloxy-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 59146564 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | ethyl (3R,4R,5S)-4-methyl-3-pentan-3-yloxy-5-(prop-2-enoxycarbonylamino)cyclohexene-1-carboxylate |
| SMILES | C=CCOC(=O)N[C@H]1CC(C(=O)OCC)=C[C@@H](OC(CC)CC)[C@@H]1C |
| InChI | InChI=1S/C19H31NO5/c1-6-10-24-19(22)20-16-11-14(18(21)23-9-4)12-17(13(16)5)25-15(7-2)8-3/h6,12-13,15-17H,1,7-11H2,2-5H3,(H,20,22)/t13-,16+,17-/m1/s1 |
| InChIKey | STGTYFOYGLDFOK-XOKHGSTOSA-N |
| XLogP | 3.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|