C28H38N2S4 — CID 59146883
2,5-bis(3-heptyl-5-methylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 59146883) has the molecular formula C28H38N2S4 and a molecular weight of 530.89 g/mol. Its IUPAC name is 2,5-bis(3-heptyl-5-methylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis(3-heptyl-5-methylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 59146883 |
| Molecular Formula | C28H38N2S4 |
| Molecular Weight | 530.89 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2,5-bis(3-heptyl-5-methylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | CCCCCCCc1cc(C)sc1-c1nc2sc(-c3sc(C)cc3CCCCCCC)nc2s1 |
| InChI | InChI=1S/C28H38N2S4/c1-5-7-9-11-13-15-21-17-19(3)31-23(21)25-29-27-28(33-25)30-26(34-27)24-22(18-20(4)32-24)16-14-12-10-8-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | AFYDAEZSMPPVRN-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.89 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|