C33H37Br2N3 — CID 59147606
2,4-bis(4-bromophenyl)-6-(3,5-dihexylphenyl)-1,3,5-triazine (PubChem CID 59147606) has the molecular formula C33H37Br2N3 and a molecular weight of 635.49 g/mol. Its IUPAC name is 2,4-bis(4-bromophenyl)-6-(3,5-dihexylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(4-bromophenyl)-6-(3,5-dihexylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59147606 |
| Molecular Formula | C33H37Br2N3 |
| Molecular Weight | 635.49 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | 2,4-bis(4-bromophenyl)-6-(3,5-dihexylphenyl)-1,3,5-triazine |
| SMILES | CCCCCCc1cc(CCCCCC)cc(-c2nc(-c3ccc(Br)cc3)nc(-c3ccc(Br)cc3)n2)c1 |
| InChI | InChI=1S/C33H37Br2N3/c1-3-5-7-9-11-24-21-25(12-10-8-6-4-2)23-28(22-24)33-37-31(26-13-17-29(34)18-14-26)36-32(38-33)27-15-19-30(35)20-16-27/h13-23H,3-12H2,1-2H3 |
| InChIKey | CZLBBYDUPALJFI-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.49 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|