C57H69Br2N3 — CID 59147607
2-[3,5-bis(3,5-dihexylphenyl)phenyl]-4,6-bis(4-bromophenyl)-1,3,5-triazine (PubChem CID 59147607) has the molecular formula C57H69Br2N3 and a molecular weight of 956.01 g/mol. Its IUPAC name is 2-[3,5-bis(3,5-dihexylphenyl)phenyl]-4,6-bis(4-bromophenyl)-1,3,5-triazine.
| Compound Name | 2-[3,5-bis(3,5-dihexylphenyl)phenyl]-4,6-bis(4-bromophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59147607 |
| Molecular Formula | C57H69Br2N3 |
| Molecular Weight | 956.01 g/mol |
| Exact Mass | 953.39 |
| IUPAC Name | 2-[3,5-bis(3,5-dihexylphenyl)phenyl]-4,6-bis(4-bromophenyl)-1,3,5-triazine |
| SMILES | CCCCCCc1cc(CCCCCC)cc(-c2cc(-c3cc(CCCCCC)cc(CCCCCC)c3)cc(-c3nc(-c4ccc(Br)cc4)nc(-c4ccc(Br)cc4)n3)c2)c1 |
| InChI | InChI=1S/C57H69Br2N3/c1-5-9-13-17-21-42-33-43(22-18-14-10-6-2)36-48(35-42)50-39-51(49-37-44(23-19-15-11-7-3)34-45(38-49)24-20-16-12-8-4)41-52(40-50)57-61-55(46-25-29-53(58)30-26-46)60-56(62-57)47-27-31-54(59)32-28-47/h25-41H,5-24H2,1-4H3 |
| InChIKey | GYZZTDBQCIQCKY-UHFFFAOYSA-N |
| XLogP | 18.22 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.01 |
| LogP ≤ 5 | 18.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|