C34H35FN4O5 — CID 59148208
5-fluoro-N-methoxy-7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 59148208) has the molecular formula C34H35FN4O5 and a molecular weight of 598.68 g/mol. Its IUPAC name is 5-fluoro-N-methoxy-7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-fluoro-N-methoxy-7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 59148208 |
| Molecular Formula | C34H35FN4O5 |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 5-fluoro-N-methoxy-7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CONc1ncnn2c([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@@]3(C)OCc3ccccc3)cc(F)c12 |
| InChI | InChI=1S/C34H35FN4O5/c1-34(43-21-26-16-10-5-11-17-26)31(28-18-27(35)30-33(38-40-2)36-23-37-39(28)30)44-29(22-41-19-24-12-6-3-7-13-24)32(34)42-20-25-14-8-4-9-15-25/h3-18,23,29,31-32H,19-22H2,1-2H3,(H,36,37,38)/t29-,31+,32-,34+/m1/s1 |
| InChIKey | JQCJTEORPOIJAF-HBBIUGOWSA-N |
| XLogP | 6.06 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|