C15H14BrFN4O4 — CID 59148351
4-(3-bromo-4-fluorophenyl)-3-[4-(4-methoxybutyl)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one (PubChem CID 59148351) has the molecular formula C15H14BrFN4O4 and a molecular weight of 413.20 g/mol. Its IUPAC name is 4-(3-bromo-4-fluorophenyl)-3-[4-(4-methoxybutyl)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one.
| Compound Name | 4-(3-bromo-4-fluorophenyl)-3-[4-(4-methoxybutyl)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 59148351 |
| Molecular Formula | C15H14BrFN4O4 |
| Molecular Weight | 413.20 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 4-(3-bromo-4-fluorophenyl)-3-[4-(4-methoxybutyl)-1,2,5-oxadiazol-3-yl]-1,2,4-oxadiazol-5-one |
| SMILES | COCCCCc1nonc1-c1noc(=O)n1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H14BrFN4O4/c1-23-7-3-2-4-12-13(19-25-18-12)14-20-24-15(22)21(14)9-5-6-11(17)10(16)8-9/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | FHZVORLVUGGTDD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|