About [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate
[1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate (PubChem CID 59148525) has the molecular formula C31H22N2O3
and a molecular weight of 470.53 g/mol. Its IUPAC name is [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate.
Molecular Properties
| Compound Name | [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate |
| PubChem CID | 59148525 |
| Molecular Formula | C31H22N2O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate |
| SMILES | CC#CC#CC#CC(=NOC(C)=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3)ccc1n2CC |
| InChI | InChI=1S/C31H22N2O3/c1-4-6-7-8-12-15-28(32-36-22(3)34)24-16-18-29-26(20-24)27-21-25(17-19-30(27)33(29)5-2)31(35)23-13-10-9-11-14-23/h9-11,13-14,16-21H,5H2,1-3H3 |
| InChIKey | GUOZUXVFPANKTB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate?
The IUPAC name of [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate (CID 59148525) is [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate.
What is the SMILES notation for [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate?
The canonical SMILES for [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate is CC#CC#CC#CC(=NOC(C)=O)c1ccc2c(c1)c1cc(C(=O)c3ccccc3)ccc1n2CC.
What is the InChIKey of [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate?
The InChIKey is GUOZUXVFPANKTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H22N2O3/c1-4-6-7-8-12-15-28(32-36-22(3)34)24-16-18-29-26(20-24)27-21-25(17-19-30(27)33(29)5-2)31(35)23-13-10-9-11-14-23/h9-11,13-14,16-21H,5H2,1-3H3.
What are the key properties of [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate?
[1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate has a molecular weight of 470.53 g/mol, XLogP of 5.34, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-benzoyl-9-ethylcarbazol-3-yl)octa-2,4,6-triynylideneamino] acetate is sourced from PubChem (CID 59148525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).