About cyclopentyl pyrimidine-5-carboxylate
cyclopentyl pyrimidine-5-carboxylate (PubChem CID 59148591) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is cyclopentyl pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | cyclopentyl pyrimidine-5-carboxylate |
| PubChem CID | 59148591 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | cyclopentyl pyrimidine-5-carboxylate |
| SMILES | O=C(OC1CCCC1)c1cncnc1 |
| InChI | InChI=1S/C10H12N2O2/c13-10(8-5-11-7-12-6-8)14-9-3-1-2-4-9/h5-7,9H,1-4H2 |
| InChIKey | DXYQABHYEPQUHJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopentyl pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl pyrimidine-5-carboxylate?
The IUPAC name of cyclopentyl pyrimidine-5-carboxylate (CID 59148591) is cyclopentyl pyrimidine-5-carboxylate.
What is the SMILES notation for cyclopentyl pyrimidine-5-carboxylate?
The canonical SMILES for cyclopentyl pyrimidine-5-carboxylate is O=C(OC1CCCC1)c1cncnc1.
What is the InChIKey of cyclopentyl pyrimidine-5-carboxylate?
The InChIKey is DXYQABHYEPQUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c13-10(8-5-11-7-12-6-8)14-9-3-1-2-4-9/h5-7,9H,1-4H2.
What are the key properties of cyclopentyl pyrimidine-5-carboxylate?
cyclopentyl pyrimidine-5-carboxylate has a molecular weight of 192.22 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl pyrimidine-5-carboxylate is sourced from PubChem (CID 59148591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).