About 1-adamantyl piperidine-1-carboxylate
1-adamantyl piperidine-1-carboxylate (PubChem CID 59148772) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-adamantyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 1-adamantyl piperidine-1-carboxylate |
| PubChem CID | 59148772 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-adamantyl piperidine-1-carboxylate |
| SMILES | O=C(OC12CC3CC(CC(C3)C1)C2)N1CCCCC1 |
| InChI | InChI=1S/C16H25NO2/c18-15(17-4-2-1-3-5-17)19-16-9-12-6-13(10-16)8-14(7-12)11-16/h12-14H,1-11H2 |
| InChIKey | KUSUCYSOHPQSGI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl piperidine-1-carboxylate?
The IUPAC name of 1-adamantyl piperidine-1-carboxylate (CID 59148772) is 1-adamantyl piperidine-1-carboxylate.
What is the SMILES notation for 1-adamantyl piperidine-1-carboxylate?
The canonical SMILES for 1-adamantyl piperidine-1-carboxylate is O=C(OC12CC3CC(CC(C3)C1)C2)N1CCCCC1.
What is the InChIKey of 1-adamantyl piperidine-1-carboxylate?
The InChIKey is KUSUCYSOHPQSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c18-15(17-4-2-1-3-5-17)19-16-9-12-6-13(10-16)8-14(7-12)11-16/h12-14H,1-11H2.
What are the key properties of 1-adamantyl piperidine-1-carboxylate?
1-adamantyl piperidine-1-carboxylate has a molecular weight of 263.38 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl piperidine-1-carboxylate is sourced from PubChem (CID 59148772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).