About (1-methylcyclohexyl) piperidine-1-carboxylate
(1-methylcyclohexyl) piperidine-1-carboxylate (PubChem CID 59148774) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is (1-methylcyclohexyl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-methylcyclohexyl) piperidine-1-carboxylate |
| PubChem CID | 59148774 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (1-methylcyclohexyl) piperidine-1-carboxylate |
| SMILES | CC1(OC(=O)N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C13H23NO2/c1-13(8-4-2-5-9-13)16-12(15)14-10-6-3-7-11-14/h2-11H2,1H3 |
| InChIKey | NLOXTULPOMVXND-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclohexyl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) piperidine-1-carboxylate?
The IUPAC name of (1-methylcyclohexyl) piperidine-1-carboxylate (CID 59148774) is (1-methylcyclohexyl) piperidine-1-carboxylate.
What is the SMILES notation for (1-methylcyclohexyl) piperidine-1-carboxylate?
The canonical SMILES for (1-methylcyclohexyl) piperidine-1-carboxylate is CC1(OC(=O)N2CCCCC2)CCCCC1.
What is the InChIKey of (1-methylcyclohexyl) piperidine-1-carboxylate?
The InChIKey is NLOXTULPOMVXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-13(8-4-2-5-9-13)16-12(15)14-10-6-3-7-11-14/h2-11H2,1H3.
What are the key properties of (1-methylcyclohexyl) piperidine-1-carboxylate?
(1-methylcyclohexyl) piperidine-1-carboxylate has a molecular weight of 225.33 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) piperidine-1-carboxylate is sourced from PubChem (CID 59148774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).