About 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate
2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate (PubChem CID 59148808) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate |
| PubChem CID | 59148808 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C11H21NO3/c1-4-11(2,3)15-10(14)12-7-5-9(13)6-8-12/h9,13H,4-8H2,1-3H3 |
| InChIKey | VWYMQCMKEVZSFW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate (CID 59148808) is 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate is CCC(C)(C)OC(=O)N1CCC(O)CC1.
What is the InChIKey of 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate?
The InChIKey is VWYMQCMKEVZSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-4-11(2,3)15-10(14)12-7-5-9(13)6-8-12/h9,13H,4-8H2,1-3H3.
What are the key properties of 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate?
2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate has a molecular weight of 215.29 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 4-hydroxypiperidine-1-carboxylate is sourced from PubChem (CID 59148808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).