C12H25O7P — CID 59148902
[(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] 3-hydroxypropyl hydrogen phosphate (PubChem CID 59148902) has the molecular formula C12H25O7P and a molecular weight of 312.30 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] 3-hydroxypropyl hydrogen phosphate.
| Compound Name | [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] 3-hydroxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 59148902 |
| Molecular Formula | C12H25O7P |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [(2R,3S,4S,5S)-4-hydroxy-5-methyl-2-(2-methylpropyl)oxolan-3-yl] 3-hydroxypropyl hydrogen phosphate |
| SMILES | CC(C)C[C@H]1O[C@@H](C)[C@H](O)[C@@H]1OP(=O)(O)OCCCO |
| InChI | InChI=1S/C12H25O7P/c1-8(2)7-10-12(11(14)9(3)18-10)19-20(15,16)17-6-4-5-13/h8-14H,4-7H2,1-3H3,(H,15,16)/t9-,10+,11-,12+/m0/s1 |
| InChIKey | KYGSRYXRKDQAPY-WHOHXGKFSA-N |
| XLogP | 1.07 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|