C23H30FN7 — CID 59148918
4-N-[2-(3-fluorophenyl)ethyl]-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 59148918) has the molecular formula C23H30FN7 and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-N-[2-(3-fluorophenyl)ethyl]-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(3-fluorophenyl)ethyl]-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59148918 |
| Molecular Formula | C23H30FN7 |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 4-N-[2-(3-fluorophenyl)ethyl]-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(CCCNc2nc(NCCc3cccc(F)c3)c3cccnc3n2)CC1 |
| InChI | InChI=1S/C23H30FN7/c1-30-13-15-31(16-14-30)12-4-10-27-23-28-21-20(7-3-9-25-21)22(29-23)26-11-8-18-5-2-6-19(24)17-18/h2-3,5-7,9,17H,4,8,10-16H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | MWKWJIYLLQOQRB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|