About CID 59149109
CID 59149109 (PubChem CID 59149109) has the molecular formula C20H36B4O7PS-
and a molecular weight of 494.79 g/mol.
Molecular Properties
| Compound Name | CID 59149109 |
| PubChem CID | 59149109 |
| Molecular Formula | C20H36B4O7PS- |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | — |
| SMILES | CC(C)OCC1OC2[B][B]C(C)C(C)[B][B]C3CC(OC(C)C)C(CSP(=O)([O-])OC1C2)O3 |
| InChI | InChI=1S/C20H37B4O7PS/c1-11(2)27-9-17-16-8-20(29-17)24-22-14(6)13(5)21-23-19-7-15(28-12(3)4)18(30-19)10-33-32(25,26)31-16/h11-20H,7-10H2,1-6H3,(H,25,26)/p-1 |
| InChIKey | YJIRSEAZQXCHRD-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 59149109 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59149109?
The IUPAC name of CID 59149109 (CID 59149109) is not available.
What is the SMILES notation for CID 59149109?
The canonical SMILES for CID 59149109 is CC(C)OCC1OC2[B][B]C(C)C(C)[B][B]C3CC(OC(C)C)C(CSP(=O)([O-])OC1C2)O3.
What is the InChIKey of CID 59149109?
The InChIKey is YJIRSEAZQXCHRD-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H37B4O7PS/c1-11(2)27-9-17-16-8-20(29-17)24-22-14(6)13(5)21-23-19-7-15(28-12(3)4)18(30-19)10-33-32(25,26)31-16/h11-20H,7-10H2,1-6H3,(H,25,26)/p-1.
What are the key properties of CID 59149109?
CID 59149109 has a molecular weight of 494.79 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59149109 is sourced from PubChem (CID 59149109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).