About 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one
3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one (PubChem CID 59149181) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one.
Molecular Properties
| Compound Name | 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one |
| PubChem CID | 59149181 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one |
| SMILES | CC(C)C1C(=O)NC2=CC=CC21 |
| InChI | InChI=1S/C10H13NO/c1-6(2)9-7-4-3-5-8(7)11-10(9)12/h3-7,9H,1-2H3,(H,11,12) |
| InChIKey | FHJXEKREOSGBMX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one?
The IUPAC name of 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one (CID 59149181) is 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one.
What is the SMILES notation for 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one?
The canonical SMILES for 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one is CC(C)C1C(=O)NC2=CC=CC21.
What is the InChIKey of 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one?
The InChIKey is FHJXEKREOSGBMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-6(2)9-7-4-3-5-8(7)11-10(9)12/h3-7,9H,1-2H3,(H,11,12).
What are the key properties of 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one?
3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one has a molecular weight of 163.22 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-3,3a-dihydro-1H-cyclopenta[b]pyrrol-2-one is sourced from PubChem (CID 59149181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).