C6H10O5 — CID 59149382
CID 59149382 (PubChem CID 59149382) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol.
| Compound Name | CID 59149382 |
|---|---|
| PubChem CID | 59149382 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | — |
| SMILES | [CH]O[C@@H]1O[C@H](CO)[C@H](O)C1O |
| InChI | InChI=1S/C6H10O5/c1-10-6-5(9)4(8)3(2-7)11-6/h1,3-9H,2H2/t3-,4+,5?,6-/m1/s1 |
| InChIKey | XYAJCQAGBWDVDF-WGDKFINWSA-N |
| XLogP | -1.89 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |