About 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one
5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 59149417) has the molecular formula C7H10N6O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 59149417 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | CC(C)N1N=NC2C(=O)N=C(N)N=C21 |
| InChI | InChI=1S/C7H10N6O/c1-3(2)13-5-4(11-12-13)6(14)10-7(8)9-5/h3-4H,1-2H3,(H2,8,10,14) |
| InChIKey | JPOCVODQIUMQGC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 95.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one (CID 59149417) is 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one is CC(C)N1N=NC2C(=O)N=C(N)N=C21.
What is the InChIKey of 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one?
The InChIKey is JPOCVODQIUMQGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O/c1-3(2)13-5-4(11-12-13)6(14)10-7(8)9-5/h3-4H,1-2H3,(H2,8,10,14).
What are the key properties of 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one?
5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one has a molecular weight of 194.20 g/mol, XLogP of -0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-propan-2-yl-7aH-triazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 59149417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).