About (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine
(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine (PubChem CID 59149660) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine |
| PubChem CID | 59149660 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine |
| SMILES | C[C@H](N)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C7H15NO2/c1-5(8)6-4-9-7(2,3)10-6/h5-6H,4,8H2,1-3H3/t5-,6+/m0/s1 |
| InChIKey | IGVMHZDCIZWZGY-NTSWFWBYSA-N |
| XLogP | 0.49 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine?
The IUPAC name of (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine (CID 59149660) is (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine.
What is the SMILES notation for (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine?
The canonical SMILES for (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine is C[C@H](N)[C@H]1COC(C)(C)O1.
What is the InChIKey of (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine?
The InChIKey is IGVMHZDCIZWZGY-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-5(8)6-4-9-7(2,3)10-6/h5-6H,4,8H2,1-3H3/t5-,6+/m0/s1.
What are the key properties of (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine?
(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine has a molecular weight of 145.20 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanamine is sourced from PubChem (CID 59149660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).