C21H21F3N8O — CID 59149787
6-[4-[4-(2-pyrazol-1-ylethoxy)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 59149787) has the molecular formula C21H21F3N8O and a molecular weight of 458.45 g/mol. Its IUPAC name is 6-[4-[4-(2-pyrazol-1-ylethoxy)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[4-[4-(2-pyrazol-1-ylethoxy)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 59149787 |
| Molecular Formula | C21H21F3N8O |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 6-[4-[4-(2-pyrazol-1-ylethoxy)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | FC(F)(F)c1nnc2ccc(N3CCN(c4ccc(OCCn5cccn5)cc4)CC3)nn12 |
| InChI | InChI=1S/C21H21F3N8O/c22-21(23,24)20-27-26-18-6-7-19(28-32(18)20)30-12-10-29(11-13-30)16-2-4-17(5-3-16)33-15-14-31-9-1-8-25-31/h1-9H,10-15H2 |
| InChIKey | CERXFDMNAPMCSW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|