C17H17F3N6 — CID 59149814
4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]aniline (PubChem CID 59149814) has the molecular formula C17H17F3N6 and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]aniline.
| Compound Name | 4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]aniline |
|---|---|
| PubChem CID | 59149814 |
| Molecular Formula | C17H17F3N6 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]aniline |
| SMILES | Nc1ccc(C2CCN(c3ccc4nnc(C(F)(F)F)n4n3)CC2)cc1 |
| InChI | InChI=1S/C17H17F3N6/c18-17(19,20)16-23-22-14-5-6-15(24-26(14)16)25-9-7-12(8-10-25)11-1-3-13(21)4-2-11/h1-6,12H,7-10,21H2 |
| InChIKey | IQBQNEVQXSTOSO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|