About 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one
6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 59150138) has the molecular formula C9H10N2O3S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| PubChem CID | 59150138 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | CNc1ccc2c(c1)NC(=O)CS2(=O)=O |
| InChI | InChI=1S/C9H10N2O3S/c1-10-6-2-3-8-7(4-6)11-9(12)5-15(8,13)14/h2-4,10H,5H2,1H3,(H,11,12) |
| InChIKey | PORGDKXBQVBVAK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The IUPAC name of 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (CID 59150138) is 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
What is the SMILES notation for 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The canonical SMILES for 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is CNc1ccc2c(c1)NC(=O)CS2(=O)=O.
What is the InChIKey of 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The InChIKey is PORGDKXBQVBVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3S/c1-10-6-2-3-8-7(4-6)11-9(12)5-15(8,13)14/h2-4,10H,5H2,1H3,(H,11,12).
What are the key properties of 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one has a molecular weight of 226.26 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylamino)-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is sourced from PubChem (CID 59150138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).