C25H23F3N2O4 — CID 59150198
(2E)-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-[7-(trifluoromethyl)spiro[3H-chromene-2,4'-oxane]-4-ylidene]acetamide (PubChem CID 59150198) has the molecular formula C25H23F3N2O4 and a molecular weight of 472.46 g/mol. Its IUPAC name is (2E)-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-[7-(trifluoromethyl)spiro[3H-chromene-2,4'-oxane]-4-ylidene]acetamide.
| Compound Name | (2E)-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-[7-(trifluoromethyl)spiro[3H-chromene-2,4'-oxane]-4-ylidene]acetamide |
|---|---|
| PubChem CID | 59150198 |
| Molecular Formula | C25H23F3N2O4 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (2E)-N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)-2-[7-(trifluoromethyl)spiro[3H-chromene-2,4'-oxane]-4-ylidene]acetamide |
| SMILES | O=C(/C=C1\CC2(CCOCC2)Oc2cc(C(F)(F)F)ccc21)Nc1ccc2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C25H23F3N2O4/c26-25(27,28)17-3-5-19-16(14-24(34-21(19)12-17)7-9-33-10-8-24)11-23(32)29-18-4-1-15-2-6-22(31)30-20(15)13-18/h1,3-5,11-13H,2,6-10,14H2,(H,29,32)(H,30,31)/b16-11+ |
| InChIKey | FSXZIIPHVGOCLS-LFIBNONCSA-N |
| XLogP | 4.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|