C38H36F3NO4 — CID 59150722
ethyl (1S,4S)-1-phenyl-4-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanoyl]-3,4-dihydro-2H-naphthalene-1-carboxylate (PubChem CID 59150722) has the molecular formula C38H36F3NO4 and a molecular weight of 627.70 g/mol. Its IUPAC name is ethyl (1S,4S)-1-phenyl-4-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanoyl]-3,4-dihydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1S,4S)-1-phenyl-4-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanoyl]-3,4-dihydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 59150722 |
| Molecular Formula | C38H36F3NO4 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | ethyl (1S,4S)-1-phenyl-4-[5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]pentanoyl]-3,4-dihydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)CC[C@H](C(=O)CCCCNC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c2ccccc21 |
| InChI | InChI=1S/C38H36F3NO4/c1-2-46-36(45)37(27-12-4-3-5-13-27)24-23-31(30-15-8-9-17-33(30)37)34(43)18-10-11-25-42-35(44)32-16-7-6-14-29(32)26-19-21-28(22-20-26)38(39,40)41/h3-9,12-17,19-22,31H,2,10-11,18,23-25H2,1H3,(H,42,44)/t31-,37-/m0/s1 |
| InChIKey | RRMFFTOJAGCHKR-WOGQQFDQSA-N |
| XLogP | 8.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|