About 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole
4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole (PubChem CID 59151156) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole |
| PubChem CID | 59151156 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole |
| SMILES | C=C1CC(C(C)(C)C)=C(C(C)(C)C)N1 |
| InChI | InChI=1S/C13H23N/c1-9-8-10(12(2,3)4)11(14-9)13(5,6)7/h14H,1,8H2,2-7H3 |
| InChIKey | VIHAGLOOCAACFS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole?
The IUPAC name of 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole (CID 59151156) is 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole.
What is the SMILES notation for 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole?
The canonical SMILES for 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole is C=C1CC(C(C)(C)C)=C(C(C)(C)C)N1.
What is the InChIKey of 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole?
The InChIKey is VIHAGLOOCAACFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-9-8-10(12(2,3)4)11(14-9)13(5,6)7/h14H,1,8H2,2-7H3.
What are the key properties of 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole?
4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole has a molecular weight of 193.33 g/mol, XLogP of 3.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-2-methylidene-1,3-dihydropyrrole is sourced from PubChem (CID 59151156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).