C17H29N5O — CID 59151509
(3aR,6aS)-5-[2-[(2R)-2-isocyanopyrrolidin-1-yl]ethylamino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 59151509) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is (3aR,6aS)-5-[2-[(2R)-2-isocyanopyrrolidin-1-yl]ethylamino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aS)-5-[2-[(2R)-2-isocyanopyrrolidin-1-yl]ethylamino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59151509 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | (3aR,6aS)-5-[2-[(2R)-2-isocyanopyrrolidin-1-yl]ethylamino]-N,N-dimethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | [C-]#[N+][C@@H]1CCCN1CCNC1C[C@@H]2CN(C(=O)N(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C17H29N5O/c1-18-16-5-4-7-21(16)8-6-19-15-9-13-11-22(12-14(13)10-15)17(23)20(2)3/h13-16,19H,4-12H2,2-3H3/t13-,14+,15?,16-/m0/s1 |
| InChIKey | MHPWSPHLCAFEKD-QXULXFAOSA-N |
| XLogP | 1.31 |
| TPSA | 43.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|