C11H20N2O4S — CID 59151526
[(3aR,6aS)-2-(dimethylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] methanesulfonate (PubChem CID 59151526) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is [(3aR,6aS)-2-(dimethylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] methanesulfonate.
| Compound Name | [(3aR,6aS)-2-(dimethylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 59151526 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [(3aR,6aS)-2-(dimethylcarbamoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl] methanesulfonate |
| SMILES | CN(C)C(=O)N1C[C@H]2CC(OS(C)(=O)=O)C[C@H]2C1 |
| InChI | InChI=1S/C11H20N2O4S/c1-12(2)11(14)13-6-8-4-10(5-9(8)7-13)17-18(3,15)16/h8-10H,4-7H2,1-3H3/t8-,9+,10? |
| InChIKey | DAMJMLBZGMPRMT-ULKQDVFKSA-N |
| XLogP | 0.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|